C11H19N3O — CID 103282925
6-(2-methylpentoxy)pyridine-2,3-diamine (PubChem CID 103282925) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is 6-(2-methylpentoxy)pyridine-2,3-diamine.
| Compound Name | 6-(2-methylpentoxy)pyridine-2,3-diamine |
|---|---|
| PubChem CID | 103282925 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 6-(2-methylpentoxy)pyridine-2,3-diamine |
| SMILES | CCCC(C)COc1ccc(N)c(N)n1 |
| InChI | InChI=1S/C11H19N3O/c1-3-4-8(2)7-15-10-6-5-9(12)11(13)14-10/h5-6,8H,3-4,7,12H2,1-2H3,(H2,13,14) |
| InChIKey | AIMDFBYPHUYDIM-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |