About 2-methylpentyl 3-piperidin-4-yloxypropanoate
2-methylpentyl 3-piperidin-4-yloxypropanoate (PubChem CID 103284367) has the molecular formula C14H27NO3
and a molecular weight of 257.37 g/mol. Its IUPAC name is 2-methylpentyl 3-piperidin-4-yloxypropanoate.
Molecular Properties
| Compound Name | 2-methylpentyl 3-piperidin-4-yloxypropanoate |
| PubChem CID | 103284367 |
| Molecular Formula | C14H27NO3 |
| Molecular Weight | 257.37 g/mol |
| Exact Mass | 257.20 |
| IUPAC Name | 2-methylpentyl 3-piperidin-4-yloxypropanoate |
| SMILES | CCCC(C)COC(=O)CCOC1CCNCC1 |
| InChI | InChI=1S/C14H27NO3/c1-3-4-12(2)11-18-14(16)7-10-17-13-5-8-15-9-6-13/h12-13,15H,3-11H2,1-2H3 |
| InChIKey | QOZMEXUSDWGHOQ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.37 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methylpentyl 3-piperidin-4-yloxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpentyl 3-piperidin-4-yloxypropanoate?
The IUPAC name of 2-methylpentyl 3-piperidin-4-yloxypropanoate (CID 103284367) is 2-methylpentyl 3-piperidin-4-yloxypropanoate.
What is the SMILES notation for 2-methylpentyl 3-piperidin-4-yloxypropanoate?
The canonical SMILES for 2-methylpentyl 3-piperidin-4-yloxypropanoate is CCCC(C)COC(=O)CCOC1CCNCC1.
What is the InChIKey of 2-methylpentyl 3-piperidin-4-yloxypropanoate?
The InChIKey is QOZMEXUSDWGHOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27NO3/c1-3-4-12(2)11-18-14(16)7-10-17-13-5-8-15-9-6-13/h12-13,15H,3-11H2,1-2H3.
What are the key properties of 2-methylpentyl 3-piperidin-4-yloxypropanoate?
2-methylpentyl 3-piperidin-4-yloxypropanoate has a molecular weight of 257.37 g/mol, XLogP of 2.12, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpentyl 3-piperidin-4-yloxypropanoate is sourced from PubChem (CID 103284367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).