C19H39NO — CID 103285214
N-[[4-tert-butyl-1-(2-methylpentoxy)cyclohexyl]methyl]ethanamine (PubChem CID 103285214) has the molecular formula C19H39NO and a molecular weight of 297.53 g/mol. Its IUPAC name is N-[[4-tert-butyl-1-(2-methylpentoxy)cyclohexyl]methyl]ethanamine.
| Compound Name | N-[[4-tert-butyl-1-(2-methylpentoxy)cyclohexyl]methyl]ethanamine |
|---|---|
| PubChem CID | 103285214 |
| Molecular Formula | C19H39NO |
| Molecular Weight | 297.53 g/mol |
| Exact Mass | 297.30 |
| IUPAC Name | N-[[4-tert-butyl-1-(2-methylpentoxy)cyclohexyl]methyl]ethanamine |
| SMILES | CCCC(C)COC1(CNCC)CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C19H39NO/c1-7-9-16(3)14-21-19(15-20-8-2)12-10-17(11-13-19)18(4,5)6/h16-17,20H,7-15H2,1-6H3 |
| InChIKey | GKBSUOOWOLGQOA-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.53 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |