C23H12F34O — CID 10328523
11-ethenoxy-1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,14,14,15,15,16,16,17,17,18,18,19,19,20,20,21,21,21-tetratriacontafluorohenicosane (PubChem CID 10328523) has the molecular formula C23H12F34O and a molecular weight of 950.28 g/mol. Its IUPAC name is 11-ethenoxy-1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,14,14,15,15,16,16,17,17,18,18,19,19,20,20,21,21,21-tetratriacontafluorohenicosane.
| Compound Name | 11-ethenoxy-1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,14,14,15,15,16,16,17,17,18,18,19,19,20,20,21,21,21-tetratriacontafluorohenicosane |
|---|---|
| PubChem CID | 10328523 |
| Molecular Formula | C23H12F34O |
| Molecular Weight | 950.28 g/mol |
| Exact Mass | 950.03 |
| IUPAC Name | 11-ethenoxy-1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,14,14,15,15,16,16,17,17,18,18,19,19,20,20,21,21,21-tetratriacontafluorohenicosane |
| SMILES | C=COC(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C23H12F34O/c1-2-58-7(3-5-8(24,25)10(28,29)12(32,33)14(36,37)16(40,41)18(44,45)20(48,49)22(52,53)54)4-6-9(26,27)11(30,31)13(34,35)15(38,39)17(42,43)19(46,47)21(50,51)23(55,56)57/h2,7H,1,3-6H2 |
| InChIKey | DHZXEDAVAYQQAS-UHFFFAOYSA-N |
| XLogP | 13.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 950.28 |
| LogP ≤ 5 | 13.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|