C11H16N4O2S — CID 103286583
5-amino-2-[2-cyanoethyl(methyl)amino]-N-methylbenzenesulfonamide (PubChem CID 103286583) has the molecular formula C11H16N4O2S and a molecular weight of 268.34 g/mol. Its IUPAC name is 5-amino-2-[2-cyanoethyl(methyl)amino]-N-methylbenzenesulfonamide.
| Compound Name | 5-amino-2-[2-cyanoethyl(methyl)amino]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 103286583 |
| Molecular Formula | C11H16N4O2S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 5-amino-2-[2-cyanoethyl(methyl)amino]-N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1cc(N)ccc1N(C)CCC#N |
| InChI | InChI=1S/C11H16N4O2S/c1-14-18(16,17)11-8-9(13)4-5-10(11)15(2)7-3-6-12/h4-5,8,14H,3,7,13H2,1-2H3 |
| InChIKey | MERNTBQWYCCGBT-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 99.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|