C15H25N3O2S — CID 103287126
5-amino-2-[(3-ethylcyclohexyl)amino]-N-methylbenzenesulfonamide (PubChem CID 103287126) has the molecular formula C15H25N3O2S and a molecular weight of 311.45 g/mol. Its IUPAC name is 5-amino-2-[(3-ethylcyclohexyl)amino]-N-methylbenzenesulfonamide.
| Compound Name | 5-amino-2-[(3-ethylcyclohexyl)amino]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 103287126 |
| Molecular Formula | C15H25N3O2S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 5-amino-2-[(3-ethylcyclohexyl)amino]-N-methylbenzenesulfonamide |
| SMILES | CCC1CCCC(Nc2ccc(N)cc2S(=O)(=O)NC)C1 |
| InChI | InChI=1S/C15H25N3O2S/c1-3-11-5-4-6-13(9-11)18-14-8-7-12(16)10-15(14)21(19,20)17-2/h7-8,10-11,13,17-18H,3-6,9,16H2,1-2H3 |
| InChIKey | LVBPYAWHPROCMI-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|