C15H24ClNOS — CID 103289869
2-[(2-chlorophenyl)methylsulfanyl]-N-(3-ethoxypropyl)propan-1-amine (PubChem CID 103289869) has the molecular formula C15H24ClNOS and a molecular weight of 301.88 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methylsulfanyl]-N-(3-ethoxypropyl)propan-1-amine.
| Compound Name | 2-[(2-chlorophenyl)methylsulfanyl]-N-(3-ethoxypropyl)propan-1-amine |
|---|---|
| PubChem CID | 103289869 |
| Molecular Formula | C15H24ClNOS |
| Molecular Weight | 301.88 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 2-[(2-chlorophenyl)methylsulfanyl]-N-(3-ethoxypropyl)propan-1-amine |
| SMILES | CCOCCCNCC(C)SCc1ccccc1Cl |
| InChI | InChI=1S/C15H24ClNOS/c1-3-18-10-6-9-17-11-13(2)19-12-14-7-4-5-8-15(14)16/h4-5,7-8,13,17H,3,6,9-12H2,1-2H3 |
| InChIKey | FLUDHQONOUNNDL-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.88 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|