C15H19F4NO — CID 103290276
3-methyl-N-[2-(2,3,5,6-tetrafluorophenoxy)ethyl]cyclohexan-1-amine (PubChem CID 103290276) has the molecular formula C15H19F4NO and a molecular weight of 305.31 g/mol. Its IUPAC name is 3-methyl-N-[2-(2,3,5,6-tetrafluorophenoxy)ethyl]cyclohexan-1-amine.
| Compound Name | 3-methyl-N-[2-(2,3,5,6-tetrafluorophenoxy)ethyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 103290276 |
| Molecular Formula | C15H19F4NO |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 3-methyl-N-[2-(2,3,5,6-tetrafluorophenoxy)ethyl]cyclohexan-1-amine |
| SMILES | CC1CCCC(NCCOc2c(F)c(F)cc(F)c2F)C1 |
| InChI | InChI=1S/C15H19F4NO/c1-9-3-2-4-10(7-9)20-5-6-21-15-13(18)11(16)8-12(17)14(15)19/h8-10,20H,2-7H2,1H3 |
| InChIKey | RYFIPBRIHZLDNG-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|