C13H14F4O2 — CID 103290555
2-ethyl-2-methyl-3-(2,3,5,6-tetrafluorophenoxy)cyclobutan-1-ol (PubChem CID 103290555) has the molecular formula C13H14F4O2 and a molecular weight of 278.24 g/mol. Its IUPAC name is 2-ethyl-2-methyl-3-(2,3,5,6-tetrafluorophenoxy)cyclobutan-1-ol.
| Compound Name | 2-ethyl-2-methyl-3-(2,3,5,6-tetrafluorophenoxy)cyclobutan-1-ol |
|---|---|
| PubChem CID | 103290555 |
| Molecular Formula | C13H14F4O2 |
| Molecular Weight | 278.24 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 2-ethyl-2-methyl-3-(2,3,5,6-tetrafluorophenoxy)cyclobutan-1-ol |
| SMILES | CCC1(C)C(O)CC1Oc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C13H14F4O2/c1-3-13(2)8(18)5-9(13)19-12-10(16)6(14)4-7(15)11(12)17/h4,8-9,18H,3,5H2,1-2H3 |
| InChIKey | PFGLLVWYYZOFDN-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.24 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|