C13H17ClN4O2 — CID 103292077
2-[4-[[(2-chloro-6-methoxyphenyl)methylamino]methyl]triazol-1-yl]ethanol (PubChem CID 103292077) has the molecular formula C13H17ClN4O2 and a molecular weight of 296.76 g/mol. Its IUPAC name is 2-[4-[[(2-chloro-6-methoxyphenyl)methylamino]methyl]triazol-1-yl]ethanol.
| Compound Name | 2-[4-[[(2-chloro-6-methoxyphenyl)methylamino]methyl]triazol-1-yl]ethanol |
|---|---|
| PubChem CID | 103292077 |
| Molecular Formula | C13H17ClN4O2 |
| Molecular Weight | 296.76 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 2-[4-[[(2-chloro-6-methoxyphenyl)methylamino]methyl]triazol-1-yl]ethanol |
| SMILES | COc1cccc(Cl)c1CNCc1cn(CCO)nn1 |
| InChI | InChI=1S/C13H17ClN4O2/c1-20-13-4-2-3-12(14)11(13)8-15-7-10-9-18(5-6-19)17-16-10/h2-4,9,15,19H,5-8H2,1H3 |
| InChIKey | WVQGQUUWYQOELI-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.76 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |