C13H11BrCl2N2O — CID 103292888
3-bromo-5-chloro-N-[(2-chloro-6-methoxyphenyl)methyl]pyridin-2-amine (PubChem CID 103292888) has the molecular formula C13H11BrCl2N2O and a molecular weight of 362.05 g/mol. Its IUPAC name is 3-bromo-5-chloro-N-[(2-chloro-6-methoxyphenyl)methyl]pyridin-2-amine.
| Compound Name | 3-bromo-5-chloro-N-[(2-chloro-6-methoxyphenyl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 103292888 |
| Molecular Formula | C13H11BrCl2N2O |
| Molecular Weight | 362.05 g/mol |
| Exact Mass | 359.94 |
| IUPAC Name | 3-bromo-5-chloro-N-[(2-chloro-6-methoxyphenyl)methyl]pyridin-2-amine |
| SMILES | COc1cccc(Cl)c1CNc1ncc(Cl)cc1Br |
| InChI | InChI=1S/C13H11BrCl2N2O/c1-19-12-4-2-3-11(16)9(12)7-18-13-10(14)5-8(15)6-17-13/h2-6H,7H2,1H3,(H,17,18) |
| InChIKey | UPLGLRFNPJCIID-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.05 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |