About 5-([1,2,4]triazolo[4,3-b]pyridazin-3-yl)pyridin-3-amine
5-([1,2,4]triazolo[4,3-b]pyridazin-3-yl)pyridin-3-amine (PubChem CID 103294017) has the molecular formula C10H8N6
and a molecular weight of 212.22 g/mol. Its IUPAC name is 5-([1,2,4]triazolo[4,3-b]pyridazin-3-yl)pyridin-3-amine.
Molecular Properties
| Compound Name | 5-([1,2,4]triazolo[4,3-b]pyridazin-3-yl)pyridin-3-amine |
| PubChem CID | 103294017 |
| Molecular Formula | C10H8N6 |
| Molecular Weight | 212.22 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 5-([1,2,4]triazolo[4,3-b]pyridazin-3-yl)pyridin-3-amine |
| SMILES | Nc1cncc(-c2nnc3cccnn23)c1 |
| InChI | InChI=1S/C10H8N6/c11-8-4-7(5-12-6-8)10-15-14-9-2-1-3-13-16(9)10/h1-6H,11H2 |
| InChIKey | TURKCBQVAOGRRX-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.22 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-([1,2,4]triazolo[4,3-b]pyridazin-3-yl)pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-([1,2,4]triazolo[4,3-b]pyridazin-3-yl)pyridin-3-amine?
The IUPAC name of 5-([1,2,4]triazolo[4,3-b]pyridazin-3-yl)pyridin-3-amine (CID 103294017) is 5-([1,2,4]triazolo[4,3-b]pyridazin-3-yl)pyridin-3-amine.
What is the SMILES notation for 5-([1,2,4]triazolo[4,3-b]pyridazin-3-yl)pyridin-3-amine?
The canonical SMILES for 5-([1,2,4]triazolo[4,3-b]pyridazin-3-yl)pyridin-3-amine is Nc1cncc(-c2nnc3cccnn23)c1.
What is the InChIKey of 5-([1,2,4]triazolo[4,3-b]pyridazin-3-yl)pyridin-3-amine?
The InChIKey is TURKCBQVAOGRRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N6/c11-8-4-7(5-12-6-8)10-15-14-9-2-1-3-13-16(9)10/h1-6H,11H2.
What are the key properties of 5-([1,2,4]triazolo[4,3-b]pyridazin-3-yl)pyridin-3-amine?
5-([1,2,4]triazolo[4,3-b]pyridazin-3-yl)pyridin-3-amine has a molecular weight of 212.22 g/mol, XLogP of 0.77, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-([1,2,4]triazolo[4,3-b]pyridazin-3-yl)pyridin-3-amine is sourced from PubChem (CID 103294017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).