C10H13N5 — CID 103294537
(5-ethyl-1-pyridazin-3-ylpyrazol-4-yl)methanamine (PubChem CID 103294537) has the molecular formula C10H13N5 and a molecular weight of 203.25 g/mol. Its IUPAC name is (5-ethyl-1-pyridazin-3-ylpyrazol-4-yl)methanamine.
| Compound Name | (5-ethyl-1-pyridazin-3-ylpyrazol-4-yl)methanamine |
|---|---|
| PubChem CID | 103294537 |
| Molecular Formula | C10H13N5 |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | (5-ethyl-1-pyridazin-3-ylpyrazol-4-yl)methanamine |
| SMILES | CCc1c(CN)cnn1-c1cccnn1 |
| InChI | InChI=1S/C10H13N5/c1-2-9-8(6-11)7-13-15(9)10-4-3-5-12-14-10/h3-5,7H,2,6,11H2,1H3 |
| InChIKey | BYYMBSUFEUSBTA-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |