C8H10OS — CID 10329483
(1R,2S,6R,7S)-10-oxa-4-thiatricyclo[5.2.1.02,6]dec-8-ene (PubChem CID 10329483) has the molecular formula C8H10OS and a molecular weight of 154.23 g/mol. Its IUPAC name is (1R,2S,6R,7S)-10-oxa-4-thiatricyclo[5.2.1.02,6]dec-8-ene.
| Compound Name | (1R,2S,6R,7S)-10-oxa-4-thiatricyclo[5.2.1.02,6]dec-8-ene |
|---|---|
| PubChem CID | 10329483 |
| Molecular Formula | C8H10OS |
| Molecular Weight | 154.23 g/mol |
| Exact Mass | 154.05 |
| IUPAC Name | (1R,2S,6R,7S)-10-oxa-4-thiatricyclo[5.2.1.02,6]dec-8-ene |
| SMILES | C1=C[C@H]2O[C@@H]1[C@@H]1CSC[C@@H]12 |
| InChI | InChI=1S/C8H10OS/c1-2-8-6-4-10-3-5(6)7(1)9-8/h1-2,5-8H,3-4H2/t5-,6+,7+,8- |
| InChIKey | HXCPDFPGLNERPT-SOSBWXJGSA-N |
| XLogP | 1.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.23 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|