C7H14O4 — CID 10329588
(3S,4R)-4-(2-hydroxyethyl)-5-methoxyoxolan-3-ol (PubChem CID 10329588) has the molecular formula C7H14O4 and a molecular weight of 162.18 g/mol. Its IUPAC name is (3S,4R)-4-(2-hydroxyethyl)-5-methoxyoxolan-3-ol.
| Compound Name | (3S,4R)-4-(2-hydroxyethyl)-5-methoxyoxolan-3-ol |
|---|---|
| PubChem CID | 10329588 |
| Molecular Formula | C7H14O4 |
| Molecular Weight | 162.18 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | (3S,4R)-4-(2-hydroxyethyl)-5-methoxyoxolan-3-ol |
| SMILES | COC1OC[C@@H](O)[C@H]1CCO |
| InChI | InChI=1S/C7H14O4/c1-10-7-5(2-3-8)6(9)4-11-7/h5-9H,2-4H2,1H3/t5-,6-,7?/m1/s1 |
| InChIKey | OUAXFCFBRRVHGO-CQMSUOBXSA-N |
| XLogP | -0.65 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.18 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |