C9H12N2O — CID 10329635
1-imidazol-1-yl-2,3-dimethylbut-3-en-1-one (PubChem CID 10329635) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is 1-imidazol-1-yl-2,3-dimethylbut-3-en-1-one.
| Compound Name | 1-imidazol-1-yl-2,3-dimethylbut-3-en-1-one |
|---|---|
| PubChem CID | 10329635 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 1-imidazol-1-yl-2,3-dimethylbut-3-en-1-one |
| SMILES | C=C(C)C(C)C(=O)n1ccnc1 |
| InChI | InChI=1S/C9H12N2O/c1-7(2)8(3)9(12)11-5-4-10-6-11/h4-6,8H,1H2,2-3H3 |
| InChIKey | LZKDFBYGABSOFO-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|