About 2-chlorohexyl formate
2-chlorohexyl formate (PubChem CID 10329640) has the molecular formula C7H13ClO2
and a molecular weight of 164.63 g/mol. Its IUPAC name is 2-chlorohexyl formate.
Molecular Properties
| Compound Name | 2-chlorohexyl formate |
| PubChem CID | 10329640 |
| Molecular Formula | C7H13ClO2 |
| Molecular Weight | 164.63 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | 2-chlorohexyl formate |
| SMILES | CCCCC(Cl)COC=O |
| InChI | InChI=1S/C7H13ClO2/c1-2-3-4-7(8)5-10-6-9/h6-7H,2-5H2,1H3 |
| InChIKey | DTHFCHXRAFSLLD-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.63 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chlorohexyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chlorohexyl formate?
The IUPAC name of 2-chlorohexyl formate (CID 10329640) is 2-chlorohexyl formate.
What is the SMILES notation for 2-chlorohexyl formate?
The canonical SMILES for 2-chlorohexyl formate is CCCCC(Cl)COC=O.
What is the InChIKey of 2-chlorohexyl formate?
The InChIKey is DTHFCHXRAFSLLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13ClO2/c1-2-3-4-7(8)5-10-6-9/h6-7H,2-5H2,1H3.
What are the key properties of 2-chlorohexyl formate?
2-chlorohexyl formate has a molecular weight of 164.63 g/mol, XLogP of 1.96, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chlorohexyl formate is sourced from PubChem (CID 10329640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).