About methyl 3-pyridin-3-ylpropanoate
methyl 3-pyridin-3-ylpropanoate (PubChem CID 10329646) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is methyl 3-pyridin-3-ylpropanoate.
Molecular Properties
| Compound Name | methyl 3-pyridin-3-ylpropanoate |
| PubChem CID | 10329646 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | methyl 3-pyridin-3-ylpropanoate |
| SMILES | COC(=O)CCc1cccnc1 |
| InChI | InChI=1S/C9H11NO2/c1-12-9(11)5-4-8-3-2-6-10-7-8/h2-3,6-7H,4-5H2,1H3 |
| InChIKey | FQRRQPZYIYAPAV-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 3-pyridin-3-ylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-pyridin-3-ylpropanoate?
The IUPAC name of methyl 3-pyridin-3-ylpropanoate (CID 10329646) is methyl 3-pyridin-3-ylpropanoate.
What is the SMILES notation for methyl 3-pyridin-3-ylpropanoate?
The canonical SMILES for methyl 3-pyridin-3-ylpropanoate is COC(=O)CCc1cccnc1.
What is the InChIKey of methyl 3-pyridin-3-ylpropanoate?
The InChIKey is FQRRQPZYIYAPAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2/c1-12-9(11)5-4-8-3-2-6-10-7-8/h2-3,6-7H,4-5H2,1H3.
What are the key properties of methyl 3-pyridin-3-ylpropanoate?
methyl 3-pyridin-3-ylpropanoate has a molecular weight of 165.19 g/mol, XLogP of 1.19, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-pyridin-3-ylpropanoate is sourced from PubChem (CID 10329646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).