About (3S,5R)-5-ethyl-3-prop-2-enyloxolane-2,4-dione
(3S,5R)-5-ethyl-3-prop-2-enyloxolane-2,4-dione (PubChem CID 10329699) has the molecular formula C9H12O3
and a molecular weight of 168.19 g/mol. Its IUPAC name is (3S,5R)-5-ethyl-3-prop-2-enyloxolane-2,4-dione.
Molecular Properties
| Compound Name | (3S,5R)-5-ethyl-3-prop-2-enyloxolane-2,4-dione |
| PubChem CID | 10329699 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | (3S,5R)-5-ethyl-3-prop-2-enyloxolane-2,4-dione |
| SMILES | C=CC[C@@H]1C(=O)O[C@H](CC)C1=O |
| InChI | InChI=1S/C9H12O3/c1-3-5-6-8(10)7(4-2)12-9(6)11/h3,6-7H,1,4-5H2,2H3/t6-,7+/m0/s1 |
| InChIKey | PEIXMSPCKRZOGC-NKWVEPMBSA-N |
| XLogP | 1.08 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3S,5R)-5-ethyl-3-prop-2-enyloxolane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,5R)-5-ethyl-3-prop-2-enyloxolane-2,4-dione?
The IUPAC name of (3S,5R)-5-ethyl-3-prop-2-enyloxolane-2,4-dione (CID 10329699) is (3S,5R)-5-ethyl-3-prop-2-enyloxolane-2,4-dione.
What is the SMILES notation for (3S,5R)-5-ethyl-3-prop-2-enyloxolane-2,4-dione?
The canonical SMILES for (3S,5R)-5-ethyl-3-prop-2-enyloxolane-2,4-dione is C=CC[C@@H]1C(=O)O[C@H](CC)C1=O.
What is the InChIKey of (3S,5R)-5-ethyl-3-prop-2-enyloxolane-2,4-dione?
The InChIKey is PEIXMSPCKRZOGC-NKWVEPMBSA-N. The full InChI is InChI=1S/C9H12O3/c1-3-5-6-8(10)7(4-2)12-9(6)11/h3,6-7H,1,4-5H2,2H3/t6-,7+/m0/s1.
What are the key properties of (3S,5R)-5-ethyl-3-prop-2-enyloxolane-2,4-dione?
(3S,5R)-5-ethyl-3-prop-2-enyloxolane-2,4-dione has a molecular weight of 168.19 g/mol, XLogP of 1.08, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,5R)-5-ethyl-3-prop-2-enyloxolane-2,4-dione is sourced from PubChem (CID 10329699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).