C12H8Br2FNOS — CID 103298331
(5-amino-2-fluoro-3-methylphenyl)-(2,5-dibromothiophen-3-yl)methanone (PubChem CID 103298331) has the molecular formula C12H8Br2FNOS and a molecular weight of 393.08 g/mol. Its IUPAC name is (5-amino-2-fluoro-3-methylphenyl)-(2,5-dibromothiophen-3-yl)methanone.
| Compound Name | (5-amino-2-fluoro-3-methylphenyl)-(2,5-dibromothiophen-3-yl)methanone |
|---|---|
| PubChem CID | 103298331 |
| Molecular Formula | C12H8Br2FNOS |
| Molecular Weight | 393.08 g/mol |
| Exact Mass | 390.87 |
| IUPAC Name | (5-amino-2-fluoro-3-methylphenyl)-(2,5-dibromothiophen-3-yl)methanone |
| SMILES | Cc1cc(N)cc(C(=O)c2cc(Br)sc2Br)c1F |
| InChI | InChI=1S/C12H8Br2FNOS/c1-5-2-6(16)3-7(10(5)15)11(17)8-4-9(13)18-12(8)14/h2-4H,16H2,1H3 |
| InChIKey | FFJVBWGKEJYHDX-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.08 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|