1-methylpyrrolo[2,3-b]pyridine-3-carboxylic acid

C9H8N2O2 — CID 10329835

IUPAC1-methylpyrrolo[2,3-b]pyridine-3-carboxylic acid
SMILESCn1cc(C(=O)O)c2cccnc21
InChIInChI=1S/C9H8N2O2/c1-11-5-7(9(12)13)6-3-2-4-10-8(6)11/h2-5H,1H3,(H,12,13)
InChIKeyKHIJNUGJNMUEFX-UHFFFAOYSA-N
MW176.17 g/mol
LogP1.27
Rot. Bonds1

About 1-methylpyrrolo[2,3-b]pyridine-3-carboxylic acid

1-methylpyrrolo[2,3-b]pyridine-3-carboxylic acid (PubChem CID 10329835) has the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. Its IUPAC name is 1-methylpyrrolo[2,3-b]pyridine-3-carboxylic acid.

Molecular Properties

Compound Name1-methylpyrrolo[2,3-b]pyridine-3-carboxylic acid
PubChem CID10329835
Molecular FormulaC9H8N2O2
Molecular Weight176.17 g/mol
Exact Mass176.06
IUPAC Name1-methylpyrrolo[2,3-b]pyridine-3-carboxylic acid
SMILESCn1cc(C(=O)O)c2cccnc21
InChIInChI=1S/C9H8N2O2/c1-11-5-7(9(12)13)6-3-2-4-10-8(6)11/h2-5H,1H3,(H,12,13)
InChIKeyKHIJNUGJNMUEFX-UHFFFAOYSA-N
XLogP1.27
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500176.17
LogP ≤ 51.27
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 1-methylpyrrolo[2,3-b]pyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-methylpyrrolo[2,3-b]pyridine-3-carboxylic acid?
The IUPAC name of 1-methylpyrrolo[2,3-b]pyridine-3-carboxylic acid (CID 10329835) is 1-methylpyrrolo[2,3-b]pyridine-3-carboxylic acid.
What is the SMILES notation for 1-methylpyrrolo[2,3-b]pyridine-3-carboxylic acid?
The canonical SMILES for 1-methylpyrrolo[2,3-b]pyridine-3-carboxylic acid is Cn1cc(C(=O)O)c2cccnc21.
What is the InChIKey of 1-methylpyrrolo[2,3-b]pyridine-3-carboxylic acid?
The InChIKey is KHIJNUGJNMUEFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O2/c1-11-5-7(9(12)13)6-3-2-4-10-8(6)11/h2-5H,1H3,(H,12,13).
What are the key properties of 1-methylpyrrolo[2,3-b]pyridine-3-carboxylic acid?
1-methylpyrrolo[2,3-b]pyridine-3-carboxylic acid has a molecular weight of 176.17 g/mol, XLogP of 1.27, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpyrrolo[2,3-b]pyridine-3-carboxylic acid is sourced from PubChem (CID 10329835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).