C11H16FN3O2S — CID 103299286
3-fluoro-N-[(1-methylpyrrolidin-3-yl)methyl]pyridine-2-sulfonamide (PubChem CID 103299286) has the molecular formula C11H16FN3O2S and a molecular weight of 273.33 g/mol. Its IUPAC name is 3-fluoro-N-[(1-methylpyrrolidin-3-yl)methyl]pyridine-2-sulfonamide.
| Compound Name | 3-fluoro-N-[(1-methylpyrrolidin-3-yl)methyl]pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 103299286 |
| Molecular Formula | C11H16FN3O2S |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 3-fluoro-N-[(1-methylpyrrolidin-3-yl)methyl]pyridine-2-sulfonamide |
| SMILES | CN1CCC(CNS(=O)(=O)c2ncccc2F)C1 |
| InChI | InChI=1S/C11H16FN3O2S/c1-15-6-4-9(8-15)7-14-18(16,17)11-10(12)3-2-5-13-11/h2-3,5,9,14H,4,6-8H2,1H3 |
| InChIKey | GPMVILPTUJBGFU-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |