C11H18FN3O2S — CID 103299907
N-[4-(dimethylamino)butan-2-yl]-3-fluoropyridine-2-sulfonamide (PubChem CID 103299907) has the molecular formula C11H18FN3O2S and a molecular weight of 275.35 g/mol. Its IUPAC name is N-[4-(dimethylamino)butan-2-yl]-3-fluoropyridine-2-sulfonamide.
| Compound Name | N-[4-(dimethylamino)butan-2-yl]-3-fluoropyridine-2-sulfonamide |
|---|---|
| PubChem CID | 103299907 |
| Molecular Formula | C11H18FN3O2S |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | N-[4-(dimethylamino)butan-2-yl]-3-fluoropyridine-2-sulfonamide |
| SMILES | CC(CCN(C)C)NS(=O)(=O)c1ncccc1F |
| InChI | InChI=1S/C11H18FN3O2S/c1-9(6-8-15(2)3)14-18(16,17)11-10(12)5-4-7-13-11/h4-5,7,9,14H,6,8H2,1-3H3 |
| InChIKey | IOUVMCQMUCZZMP-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |