C10H13FN2O3S — CID 103300080
3-fluoro-N-(oxan-3-yl)pyridine-2-sulfonamide (PubChem CID 103300080) has the molecular formula C10H13FN2O3S and a molecular weight of 260.29 g/mol. Its IUPAC name is 3-fluoro-N-(oxan-3-yl)pyridine-2-sulfonamide.
| Compound Name | 3-fluoro-N-(oxan-3-yl)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 103300080 |
| Molecular Formula | C10H13FN2O3S |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 3-fluoro-N-(oxan-3-yl)pyridine-2-sulfonamide |
| SMILES | O=S(=O)(NC1CCCOC1)c1ncccc1F |
| InChI | InChI=1S/C10H13FN2O3S/c11-9-4-1-5-12-10(9)17(14,15)13-8-3-2-6-16-7-8/h1,4-5,8,13H,2-3,6-7H2 |
| InChIKey | ZBVVKGRKJVGBAQ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |