C9H12O4 — CID 10330020
3,4-diethoxy-5-methylidenefuran-2-one (PubChem CID 10330020) has the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. Its IUPAC name is 3,4-diethoxy-5-methylidenefuran-2-one.
| Compound Name | 3,4-diethoxy-5-methylidenefuran-2-one |
|---|---|
| PubChem CID | 10330020 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 3,4-diethoxy-5-methylidenefuran-2-one |
| SMILES | C=C1OC(=O)C(OCC)=C1OCC |
| InChI | InChI=1S/C9H12O4/c1-4-11-7-6(3)13-9(10)8(7)12-5-2/h3-5H2,1-2H3 |
| InChIKey | NLECRADAAIGMLV-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |