About N-(2,3-dihydroxypropyl)-3-fluoropyridine-2-sulfonamide
N-(2,3-dihydroxypropyl)-3-fluoropyridine-2-sulfonamide (PubChem CID 103300213) has the molecular formula C8H11FN2O4S
and a molecular weight of 250.25 g/mol. Its IUPAC name is N-(2,3-dihydroxypropyl)-3-fluoropyridine-2-sulfonamide.
Molecular Properties
| Compound Name | N-(2,3-dihydroxypropyl)-3-fluoropyridine-2-sulfonamide |
| PubChem CID | 103300213 |
| Molecular Formula | C8H11FN2O4S |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | N-(2,3-dihydroxypropyl)-3-fluoropyridine-2-sulfonamide |
| SMILES | O=S(=O)(NCC(O)CO)c1ncccc1F |
| InChI | InChI=1S/C8H11FN2O4S/c9-7-2-1-3-10-8(7)16(14,15)11-4-6(13)5-12/h1-3,6,11-13H,4-5H2 |
| InChIKey | YIIMJKJLOUNWLP-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(2,3-dihydroxypropyl)-3-fluoropyridine-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,3-dihydroxypropyl)-3-fluoropyridine-2-sulfonamide?
The IUPAC name of N-(2,3-dihydroxypropyl)-3-fluoropyridine-2-sulfonamide (CID 103300213) is N-(2,3-dihydroxypropyl)-3-fluoropyridine-2-sulfonamide.
What is the SMILES notation for N-(2,3-dihydroxypropyl)-3-fluoropyridine-2-sulfonamide?
The canonical SMILES for N-(2,3-dihydroxypropyl)-3-fluoropyridine-2-sulfonamide is O=S(=O)(NCC(O)CO)c1ncccc1F.
What is the InChIKey of N-(2,3-dihydroxypropyl)-3-fluoropyridine-2-sulfonamide?
The InChIKey is YIIMJKJLOUNWLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11FN2O4S/c9-7-2-1-3-10-8(7)16(14,15)11-4-6(13)5-12/h1-3,6,11-13H,4-5H2.
What are the key properties of N-(2,3-dihydroxypropyl)-3-fluoropyridine-2-sulfonamide?
N-(2,3-dihydroxypropyl)-3-fluoropyridine-2-sulfonamide has a molecular weight of 250.25 g/mol, XLogP of -1.15, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,3-dihydroxypropyl)-3-fluoropyridine-2-sulfonamide is sourced from PubChem (CID 103300213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).