C7H9FN2O3 — CID 10330097
1-(3-fluoro-2-hydroxypropyl)pyrimidine-2,4-dione (PubChem CID 10330097) has the molecular formula C7H9FN2O3 and a molecular weight of 188.16 g/mol. Its IUPAC name is 1-(3-fluoro-2-hydroxypropyl)pyrimidine-2,4-dione.
| Compound Name | 1-(3-fluoro-2-hydroxypropyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10330097 |
| Molecular Formula | C7H9FN2O3 |
| Molecular Weight | 188.16 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | 1-(3-fluoro-2-hydroxypropyl)pyrimidine-2,4-dione |
| SMILES | O=c1ccn(CC(O)CF)c(=O)[nH]1 |
| InChI | InChI=1S/C7H9FN2O3/c8-3-5(11)4-10-2-1-6(12)9-7(10)13/h1-2,5,11H,3-4H2,(H,9,12,13) |
| InChIKey | KUEMWWLJTMJCET-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.16 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |