C9H14N4O3S — CID 103301477
1-[(3-hydrazinyl-2-pyridinyl)sulfonyl]pyrrolidin-3-ol (PubChem CID 103301477) has the molecular formula C9H14N4O3S and a molecular weight of 258.30 g/mol. Its IUPAC name is 1-[(3-hydrazinyl-2-pyridinyl)sulfonyl]pyrrolidin-3-ol.
| Compound Name | 1-[(3-hydrazinyl-2-pyridinyl)sulfonyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 103301477 |
| Molecular Formula | C9H14N4O3S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 1-[(3-hydrazinyl-2-pyridinyl)sulfonyl]pyrrolidin-3-ol |
| SMILES | NNc1cccnc1S(=O)(=O)N1CCC(O)C1 |
| InChI | InChI=1S/C9H14N4O3S/c10-12-8-2-1-4-11-9(8)17(15,16)13-5-3-7(14)6-13/h1-2,4,7,12,14H,3,5-6,10H2 |
| InChIKey | BCLQCOPYDVGBJY-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 108.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|