About (2-methyloxolan-2-yl)-(2,4,5-trifluorophenyl)methanamine
(2-methyloxolan-2-yl)-(2,4,5-trifluorophenyl)methanamine (PubChem CID 103301746) has the molecular formula C12H14F3NO
and a molecular weight of 245.24 g/mol. Its IUPAC name is (2-methyloxolan-2-yl)-(2,4,5-trifluorophenyl)methanamine.
Molecular Properties
| Compound Name | (2-methyloxolan-2-yl)-(2,4,5-trifluorophenyl)methanamine |
| PubChem CID | 103301746 |
| Molecular Formula | C12H14F3NO |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | (2-methyloxolan-2-yl)-(2,4,5-trifluorophenyl)methanamine |
| SMILES | CC1(C(N)c2cc(F)c(F)cc2F)CCCO1 |
| InChI | InChI=1S/C12H14F3NO/c1-12(3-2-4-17-12)11(16)7-5-9(14)10(15)6-8(7)13/h5-6,11H,2-4,16H2,1H3 |
| InChIKey | DYYGBIHENHJHGZ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze (2-methyloxolan-2-yl)-(2,4,5-trifluorophenyl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyloxolan-2-yl)-(2,4,5-trifluorophenyl)methanamine?
The IUPAC name of (2-methyloxolan-2-yl)-(2,4,5-trifluorophenyl)methanamine (CID 103301746) is (2-methyloxolan-2-yl)-(2,4,5-trifluorophenyl)methanamine.
What is the SMILES notation for (2-methyloxolan-2-yl)-(2,4,5-trifluorophenyl)methanamine?
The canonical SMILES for (2-methyloxolan-2-yl)-(2,4,5-trifluorophenyl)methanamine is CC1(C(N)c2cc(F)c(F)cc2F)CCCO1.
What is the InChIKey of (2-methyloxolan-2-yl)-(2,4,5-trifluorophenyl)methanamine?
The InChIKey is DYYGBIHENHJHGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14F3NO/c1-12(3-2-4-17-12)11(16)7-5-9(14)10(15)6-8(7)13/h5-6,11H,2-4,16H2,1H3.
What are the key properties of (2-methyloxolan-2-yl)-(2,4,5-trifluorophenyl)methanamine?
(2-methyloxolan-2-yl)-(2,4,5-trifluorophenyl)methanamine has a molecular weight of 245.24 g/mol, XLogP of 2.67, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyloxolan-2-yl)-(2,4,5-trifluorophenyl)methanamine is sourced from PubChem (CID 103301746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).