C10H9F6N — CID 103302130
3,3,3-trifluoro-N-methyl-1-(2,4,5-trifluorophenyl)propan-1-amine (PubChem CID 103302130) has the molecular formula C10H9F6N and a molecular weight of 257.18 g/mol. Its IUPAC name is 3,3,3-trifluoro-N-methyl-1-(2,4,5-trifluorophenyl)propan-1-amine.
| Compound Name | 3,3,3-trifluoro-N-methyl-1-(2,4,5-trifluorophenyl)propan-1-amine |
|---|---|
| PubChem CID | 103302130 |
| Molecular Formula | C10H9F6N |
| Molecular Weight | 257.18 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | 3,3,3-trifluoro-N-methyl-1-(2,4,5-trifluorophenyl)propan-1-amine |
| SMILES | CNC(CC(F)(F)F)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C10H9F6N/c1-17-9(4-10(14,15)16)5-2-7(12)8(13)3-6(5)11/h2-3,9,17H,4H2,1H3 |
| InChIKey | TZOLMYYDYAATRY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.18 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|