C17H22F3N — CID 103302763
2-(2-bicyclo[2.2.1]heptanyl)-N-ethyl-1-(2,4,5-trifluorophenyl)ethanamine (PubChem CID 103302763) has the molecular formula C17H22F3N and a molecular weight of 297.36 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanyl)-N-ethyl-1-(2,4,5-trifluorophenyl)ethanamine.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanyl)-N-ethyl-1-(2,4,5-trifluorophenyl)ethanamine |
|---|---|
| PubChem CID | 103302763 |
| Molecular Formula | C17H22F3N |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanyl)-N-ethyl-1-(2,4,5-trifluorophenyl)ethanamine |
| SMILES | CCNC(CC1CC2CCC1C2)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C17H22F3N/c1-2-21-17(7-12-6-10-3-4-11(12)5-10)13-8-15(19)16(20)9-14(13)18/h8-12,17,21H,2-7H2,1H3 |
| InChIKey | POPYFUKIJGKECG-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|