C17H26F3N — CID 103302785
N-ethyl-1-(2,4,5-trifluorophenyl)nonan-1-amine (PubChem CID 103302785) has the molecular formula C17H26F3N and a molecular weight of 301.40 g/mol. Its IUPAC name is N-ethyl-1-(2,4,5-trifluorophenyl)nonan-1-amine.
| Compound Name | N-ethyl-1-(2,4,5-trifluorophenyl)nonan-1-amine |
|---|---|
| PubChem CID | 103302785 |
| Molecular Formula | C17H26F3N |
| Molecular Weight | 301.40 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | N-ethyl-1-(2,4,5-trifluorophenyl)nonan-1-amine |
| SMILES | CCCCCCCCC(NCC)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C17H26F3N/c1-3-5-6-7-8-9-10-17(21-4-2)13-11-15(19)16(20)12-14(13)18/h11-12,17,21H,3-10H2,1-2H3 |
| InChIKey | MXDUDPRYGSECJP-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.40 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|