About 2-(ethylamino)-4,5-dihydroxybenzamide
2-(ethylamino)-4,5-dihydroxybenzamide (PubChem CID 10330295) has the molecular formula C9H12N2O3
and a molecular weight of 196.21 g/mol. Its IUPAC name is 2-(ethylamino)-4,5-dihydroxybenzamide.
Molecular Properties
| Compound Name | 2-(ethylamino)-4,5-dihydroxybenzamide |
| PubChem CID | 10330295 |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 2-(ethylamino)-4,5-dihydroxybenzamide |
| SMILES | CCNc1cc(O)c(O)cc1C(N)=O |
| InChI | InChI=1S/C9H12N2O3/c1-2-11-6-4-8(13)7(12)3-5(6)9(10)14/h3-4,11-13H,2H2,1H3,(H2,10,14) |
| InChIKey | VAWDXOCBSZJIEL-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 2-(ethylamino)-4,5-dihydroxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(ethylamino)-4,5-dihydroxybenzamide?
The IUPAC name of 2-(ethylamino)-4,5-dihydroxybenzamide (CID 10330295) is 2-(ethylamino)-4,5-dihydroxybenzamide.
What is the SMILES notation for 2-(ethylamino)-4,5-dihydroxybenzamide?
The canonical SMILES for 2-(ethylamino)-4,5-dihydroxybenzamide is CCNc1cc(O)c(O)cc1C(N)=O.
What is the InChIKey of 2-(ethylamino)-4,5-dihydroxybenzamide?
The InChIKey is VAWDXOCBSZJIEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O3/c1-2-11-6-4-8(13)7(12)3-5(6)9(10)14/h3-4,11-13H,2H2,1H3,(H2,10,14).
What are the key properties of 2-(ethylamino)-4,5-dihydroxybenzamide?
2-(ethylamino)-4,5-dihydroxybenzamide has a molecular weight of 196.21 g/mol, XLogP of 0.63, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(ethylamino)-4,5-dihydroxybenzamide is sourced from PubChem (CID 10330295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).