C10H10F3NO3 — CID 103303047
2-[2-amino-2-(2,4,5-trifluorophenyl)ethoxy]acetic acid (PubChem CID 103303047) has the molecular formula C10H10F3NO3 and a molecular weight of 249.19 g/mol. Its IUPAC name is 2-[2-amino-2-(2,4,5-trifluorophenyl)ethoxy]acetic acid.
| Compound Name | 2-[2-amino-2-(2,4,5-trifluorophenyl)ethoxy]acetic acid |
|---|---|
| PubChem CID | 103303047 |
| Molecular Formula | C10H10F3NO3 |
| Molecular Weight | 249.19 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 2-[2-amino-2-(2,4,5-trifluorophenyl)ethoxy]acetic acid |
| SMILES | NC(COCC(=O)O)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C10H10F3NO3/c11-6-2-8(13)7(12)1-5(6)9(14)3-17-4-10(15)16/h1-2,9H,3-4,14H2,(H,15,16) |
| InChIKey | YPKILAOSJUTMAS-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.19 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|