C14H12O — CID 10330307
5,6,11,12-tetradehydro-7,8,9,10-tetrahydrobenzo[10]annulen-7-ol (PubChem CID 10330307) has the molecular formula C14H12O and a molecular weight of 196.25 g/mol. Its IUPAC name is 5,6,11,12-tetradehydro-7,8,9,10-tetrahydrobenzo[10]annulen-7-ol.
| Compound Name | 5,6,11,12-tetradehydro-7,8,9,10-tetrahydrobenzo[10]annulen-7-ol |
|---|---|
| PubChem CID | 10330307 |
| Molecular Formula | C14H12O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | 5,6,11,12-tetradehydro-7,8,9,10-tetrahydrobenzo[10]annulen-7-ol |
| SMILES | OC1C#Cc2ccccc2C#CCCC1 |
| InChI | InChI=1S/C14H12O/c15-14-9-3-1-2-6-12-7-4-5-8-13(12)10-11-14/h4-5,7-8,14-15H,1,3,9H2 |
| InChIKey | WVMVRQFAJGNBCE-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|