C15H13F3O — CID 103303353
(4-ethylphenyl)-(2,4,5-trifluorophenyl)methanol (PubChem CID 103303353) has the molecular formula C15H13F3O and a molecular weight of 266.26 g/mol. Its IUPAC name is (4-ethylphenyl)-(2,4,5-trifluorophenyl)methanol.
| Compound Name | (4-ethylphenyl)-(2,4,5-trifluorophenyl)methanol |
|---|---|
| PubChem CID | 103303353 |
| Molecular Formula | C15H13F3O |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | (4-ethylphenyl)-(2,4,5-trifluorophenyl)methanol |
| SMILES | CCc1ccc(C(O)c2cc(F)c(F)cc2F)cc1 |
| InChI | InChI=1S/C15H13F3O/c1-2-9-3-5-10(6-4-9)15(19)11-7-13(17)14(18)8-12(11)16/h3-8,15,19H,2H2,1H3 |
| InChIKey | ZUYIULPLKAXYCP-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|