tert-butyl (4S)-4-methyl-2-oxopyrrolidine-1-carboxylate

C10H17NO3 — CID 10330385

IUPACtert-butyl (4S)-4-methyl-2-oxopyrrolidine-1-carboxylate
SMILESC[C@H]1CC(=O)N(C(=O)OC(C)(C)C)C1
InChIInChI=1S/C10H17NO3/c1-7-5-8(12)11(6-7)9(13)14-10(2,3)4/h7H,5-6H2,1-4H3/t7-/m0/s1
InChIKeyIFGUVHBGNIDWDJ-ZETCQYMHSA-N
MW199.25 g/mol
LogP1.79
Rot. Bonds

About tert-butyl (4S)-4-methyl-2-oxopyrrolidine-1-carboxylate

tert-butyl (4S)-4-methyl-2-oxopyrrolidine-1-carboxylate (PubChem CID 10330385) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is tert-butyl (4S)-4-methyl-2-oxopyrrolidine-1-carboxylate.

Molecular Properties

Compound Nametert-butyl (4S)-4-methyl-2-oxopyrrolidine-1-carboxylate
PubChem CID10330385
Molecular FormulaC10H17NO3
Molecular Weight199.25 g/mol
Exact Mass199.12
IUPAC Nametert-butyl (4S)-4-methyl-2-oxopyrrolidine-1-carboxylate
SMILESC[C@H]1CC(=O)N(C(=O)OC(C)(C)C)C1
InChIInChI=1S/C10H17NO3/c1-7-5-8(12)11(6-7)9(13)14-10(2,3)4/h7H,5-6H2,1-4H3/t7-/m0/s1
InChIKeyIFGUVHBGNIDWDJ-ZETCQYMHSA-N
XLogP1.79
TPSA46.61 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500199.25
LogP ≤ 51.79
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze tert-butyl (4S)-4-methyl-2-oxopyrrolidine-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of tert-butyl (4S)-4-methyl-2-oxopyrrolidine-1-carboxylate?
The IUPAC name of tert-butyl (4S)-4-methyl-2-oxopyrrolidine-1-carboxylate (CID 10330385) is tert-butyl (4S)-4-methyl-2-oxopyrrolidine-1-carboxylate.
What is the SMILES notation for tert-butyl (4S)-4-methyl-2-oxopyrrolidine-1-carboxylate?
The canonical SMILES for tert-butyl (4S)-4-methyl-2-oxopyrrolidine-1-carboxylate is C[C@H]1CC(=O)N(C(=O)OC(C)(C)C)C1.
What is the InChIKey of tert-butyl (4S)-4-methyl-2-oxopyrrolidine-1-carboxylate?
The InChIKey is IFGUVHBGNIDWDJ-ZETCQYMHSA-N. The full InChI is InChI=1S/C10H17NO3/c1-7-5-8(12)11(6-7)9(13)14-10(2,3)4/h7H,5-6H2,1-4H3/t7-/m0/s1.
What are the key properties of tert-butyl (4S)-4-methyl-2-oxopyrrolidine-1-carboxylate?
tert-butyl (4S)-4-methyl-2-oxopyrrolidine-1-carboxylate has a molecular weight of 199.25 g/mol, XLogP of 1.79, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (4S)-4-methyl-2-oxopyrrolidine-1-carboxylate is sourced from PubChem (CID 10330385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).