C11H9F2N3O2S — CID 103304250
3-amino-N-(2,6-difluorophenyl)pyridine-2-sulfonamide (PubChem CID 103304250) has the molecular formula C11H9F2N3O2S and a molecular weight of 285.27 g/mol. Its IUPAC name is 3-amino-N-(2,6-difluorophenyl)pyridine-2-sulfonamide.
| Compound Name | 3-amino-N-(2,6-difluorophenyl)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 103304250 |
| Molecular Formula | C11H9F2N3O2S |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 3-amino-N-(2,6-difluorophenyl)pyridine-2-sulfonamide |
| SMILES | Nc1cccnc1S(=O)(=O)Nc1c(F)cccc1F |
| InChI | InChI=1S/C11H9F2N3O2S/c12-7-3-1-4-8(13)10(7)16-19(17,18)11-9(14)5-2-6-15-11/h1-6,16H,14H2 |
| InChIKey | REDSHRKEEAIDTQ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |