C11H11F3O — CID 103304622
4,6,7-trifluoro-3,3-dimethyl-1,2-dihydroinden-1-ol (PubChem CID 103304622) has the molecular formula C11H11F3O and a molecular weight of 216.20 g/mol. Its IUPAC name is 4,6,7-trifluoro-3,3-dimethyl-1,2-dihydroinden-1-ol.
| Compound Name | 4,6,7-trifluoro-3,3-dimethyl-1,2-dihydroinden-1-ol |
|---|---|
| PubChem CID | 103304622 |
| Molecular Formula | C11H11F3O |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 4,6,7-trifluoro-3,3-dimethyl-1,2-dihydroinden-1-ol |
| SMILES | CC1(C)CC(O)c2c(F)c(F)cc(F)c21 |
| InChI | InChI=1S/C11H11F3O/c1-11(2)4-7(15)8-9(11)5(12)3-6(13)10(8)14/h3,7,15H,4H2,1-2H3 |
| InChIKey | DXAXANZJWUTBFO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|