C10H8BrF3 — CID 103304648
1-bromo-5,7,8-trifluoro-1,2,3,4-tetrahydronaphthalene (PubChem CID 103304648) has the molecular formula C10H8BrF3 and a molecular weight of 265.07 g/mol. Its IUPAC name is 1-bromo-5,7,8-trifluoro-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 1-bromo-5,7,8-trifluoro-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 103304648 |
| Molecular Formula | C10H8BrF3 |
| Molecular Weight | 265.07 g/mol |
| Exact Mass | 263.98 |
| IUPAC Name | 1-bromo-5,7,8-trifluoro-1,2,3,4-tetrahydronaphthalene |
| SMILES | Fc1cc(F)c2c(c1F)C(Br)CCC2 |
| InChI | InChI=1S/C10H8BrF3/c11-6-3-1-2-5-7(12)4-8(13)10(14)9(5)6/h4,6H,1-3H2 |
| InChIKey | ANAJNUOPVZQGOI-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.07 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|