About N-propan-2-yl-5-(2,4,5-trifluorophenyl)pentan-1-amine
N-propan-2-yl-5-(2,4,5-trifluorophenyl)pentan-1-amine (PubChem CID 103304826) has the molecular formula C14H20F3N
and a molecular weight of 259.31 g/mol. Its IUPAC name is N-propan-2-yl-5-(2,4,5-trifluorophenyl)pentan-1-amine.
Molecular Properties
| Compound Name | N-propan-2-yl-5-(2,4,5-trifluorophenyl)pentan-1-amine |
| PubChem CID | 103304826 |
| Molecular Formula | C14H20F3N |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | N-propan-2-yl-5-(2,4,5-trifluorophenyl)pentan-1-amine |
| SMILES | CC(C)NCCCCCc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C14H20F3N/c1-10(2)18-7-5-3-4-6-11-8-13(16)14(17)9-12(11)15/h8-10,18H,3-7H2,1-2H3 |
| InChIKey | ZBOWZZGORYVJJA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze N-propan-2-yl-5-(2,4,5-trifluorophenyl)pentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propan-2-yl-5-(2,4,5-trifluorophenyl)pentan-1-amine?
The IUPAC name of N-propan-2-yl-5-(2,4,5-trifluorophenyl)pentan-1-amine (CID 103304826) is N-propan-2-yl-5-(2,4,5-trifluorophenyl)pentan-1-amine.
What is the SMILES notation for N-propan-2-yl-5-(2,4,5-trifluorophenyl)pentan-1-amine?
The canonical SMILES for N-propan-2-yl-5-(2,4,5-trifluorophenyl)pentan-1-amine is CC(C)NCCCCCc1cc(F)c(F)cc1F.
What is the InChIKey of N-propan-2-yl-5-(2,4,5-trifluorophenyl)pentan-1-amine?
The InChIKey is ZBOWZZGORYVJJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20F3N/c1-10(2)18-7-5-3-4-6-11-8-13(16)14(17)9-12(11)15/h8-10,18H,3-7H2,1-2H3.
What are the key properties of N-propan-2-yl-5-(2,4,5-trifluorophenyl)pentan-1-amine?
N-propan-2-yl-5-(2,4,5-trifluorophenyl)pentan-1-amine has a molecular weight of 259.31 g/mol, XLogP of 3.81, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-propan-2-yl-5-(2,4,5-trifluorophenyl)pentan-1-amine is sourced from PubChem (CID 103304826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).