C14H21N3O3S — CID 103305199
2-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-ylsulfonyl)-N-ethylpyridin-3-amine (PubChem CID 103305199) has the molecular formula C14H21N3O3S and a molecular weight of 311.41 g/mol. Its IUPAC name is 2-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-ylsulfonyl)-N-ethylpyridin-3-amine.
| Compound Name | 2-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-ylsulfonyl)-N-ethylpyridin-3-amine |
|---|---|
| PubChem CID | 103305199 |
| Molecular Formula | C14H21N3O3S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 2-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-ylsulfonyl)-N-ethylpyridin-3-amine |
| SMILES | CCNc1cccnc1S(=O)(=O)N1CCOC2CCCC21 |
| InChI | InChI=1S/C14H21N3O3S/c1-2-15-11-5-4-8-16-14(11)21(18,19)17-9-10-20-13-7-3-6-12(13)17/h4-5,8,12-13,15H,2-3,6-7,9-10H2,1H3 |
| InChIKey | AOYPHXAORBDBDQ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |