C14H24N4O2S — CID 103305346
N-(1-ethylpiperidin-4-yl)-N-methyl-3-(methylamino)pyridine-2-sulfonamide (PubChem CID 103305346) has the molecular formula C14H24N4O2S and a molecular weight of 312.44 g/mol. Its IUPAC name is N-(1-ethylpiperidin-4-yl)-N-methyl-3-(methylamino)pyridine-2-sulfonamide.
| Compound Name | N-(1-ethylpiperidin-4-yl)-N-methyl-3-(methylamino)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 103305346 |
| Molecular Formula | C14H24N4O2S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | N-(1-ethylpiperidin-4-yl)-N-methyl-3-(methylamino)pyridine-2-sulfonamide |
| SMILES | CCN1CCC(N(C)S(=O)(=O)c2ncccc2NC)CC1 |
| InChI | InChI=1S/C14H24N4O2S/c1-4-18-10-7-12(8-11-18)17(3)21(19,20)14-13(15-2)6-5-9-16-14/h5-6,9,12,15H,4,7-8,10-11H2,1-3H3 |
| InChIKey | OFIWKJHUZOWLMA-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |