C12H16N4O3S — CID 103306623
N-(1,2-oxazol-3-ylmethyl)-3-(propylamino)pyridine-2-sulfonamide (PubChem CID 103306623) has the molecular formula C12H16N4O3S and a molecular weight of 296.35 g/mol. Its IUPAC name is N-(1,2-oxazol-3-ylmethyl)-3-(propylamino)pyridine-2-sulfonamide.
| Compound Name | N-(1,2-oxazol-3-ylmethyl)-3-(propylamino)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 103306623 |
| Molecular Formula | C12H16N4O3S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | N-(1,2-oxazol-3-ylmethyl)-3-(propylamino)pyridine-2-sulfonamide |
| SMILES | CCCNc1cccnc1S(=O)(=O)NCc1ccon1 |
| InChI | InChI=1S/C12H16N4O3S/c1-2-6-13-11-4-3-7-14-12(11)20(17,18)15-9-10-5-8-19-16-10/h3-5,7-8,13,15H,2,6,9H2,1H3 |
| InChIKey | HDNCZENHZVRPEV-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |