C7H11N3O3S2 — CID 103307161
2-(aminomethyl)-N-ethylsulfonyl-1,3-thiazole-4-carboxamide (PubChem CID 103307161) has the molecular formula C7H11N3O3S2 and a molecular weight of 249.32 g/mol. Its IUPAC name is 2-(aminomethyl)-N-ethylsulfonyl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(aminomethyl)-N-ethylsulfonyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 103307161 |
| Molecular Formula | C7H11N3O3S2 |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.02 |
| IUPAC Name | 2-(aminomethyl)-N-ethylsulfonyl-1,3-thiazole-4-carboxamide |
| SMILES | CCS(=O)(=O)NC(=O)c1csc(CN)n1 |
| InChI | InChI=1S/C7H11N3O3S2/c1-2-15(12,13)10-7(11)5-4-14-6(3-8)9-5/h4H,2-3,8H2,1H3,(H,10,11) |
| InChIKey | ZZSLUQJXVYZLQC-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |