About N-propylsulfonyl-2-(2,2,2-trifluoroethylamino)acetamide
N-propylsulfonyl-2-(2,2,2-trifluoroethylamino)acetamide (PubChem CID 103307237) has the molecular formula C7H13F3N2O3S
and a molecular weight of 262.25 g/mol. Its IUPAC name is N-propylsulfonyl-2-(2,2,2-trifluoroethylamino)acetamide.
Molecular Properties
| Compound Name | N-propylsulfonyl-2-(2,2,2-trifluoroethylamino)acetamide |
| PubChem CID | 103307237 |
| Molecular Formula | C7H13F3N2O3S |
| Molecular Weight | 262.25 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | N-propylsulfonyl-2-(2,2,2-trifluoroethylamino)acetamide |
| SMILES | CCCS(=O)(=O)NC(=O)CNCC(F)(F)F |
| InChI | InChI=1S/C7H13F3N2O3S/c1-2-3-16(14,15)12-6(13)4-11-5-7(8,9)10/h11H,2-5H2,1H3,(H,12,13) |
| InChIKey | OOAZMAKCWCGGGG-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.25 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-propylsulfonyl-2-(2,2,2-trifluoroethylamino)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propylsulfonyl-2-(2,2,2-trifluoroethylamino)acetamide?
The IUPAC name of N-propylsulfonyl-2-(2,2,2-trifluoroethylamino)acetamide (CID 103307237) is N-propylsulfonyl-2-(2,2,2-trifluoroethylamino)acetamide.
What is the SMILES notation for N-propylsulfonyl-2-(2,2,2-trifluoroethylamino)acetamide?
The canonical SMILES for N-propylsulfonyl-2-(2,2,2-trifluoroethylamino)acetamide is CCCS(=O)(=O)NC(=O)CNCC(F)(F)F.
What is the InChIKey of N-propylsulfonyl-2-(2,2,2-trifluoroethylamino)acetamide?
The InChIKey is OOAZMAKCWCGGGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13F3N2O3S/c1-2-3-16(14,15)12-6(13)4-11-5-7(8,9)10/h11H,2-5H2,1H3,(H,12,13).
What are the key properties of N-propylsulfonyl-2-(2,2,2-trifluoroethylamino)acetamide?
N-propylsulfonyl-2-(2,2,2-trifluoroethylamino)acetamide has a molecular weight of 262.25 g/mol, XLogP of -0.01, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-propylsulfonyl-2-(2,2,2-trifluoroethylamino)acetamide is sourced from PubChem (CID 103307237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).