C13H23N3O2S2 — CID 103307489
N-(1-methylsulfanylbutan-2-yl)-3-(propylamino)pyridine-2-sulfonamide (PubChem CID 103307489) has the molecular formula C13H23N3O2S2 and a molecular weight of 317.48 g/mol. Its IUPAC name is N-(1-methylsulfanylbutan-2-yl)-3-(propylamino)pyridine-2-sulfonamide.
| Compound Name | N-(1-methylsulfanylbutan-2-yl)-3-(propylamino)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 103307489 |
| Molecular Formula | C13H23N3O2S2 |
| Molecular Weight | 317.48 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | N-(1-methylsulfanylbutan-2-yl)-3-(propylamino)pyridine-2-sulfonamide |
| SMILES | CCCNc1cccnc1S(=O)(=O)NC(CC)CSC |
| InChI | InChI=1S/C13H23N3O2S2/c1-4-8-14-12-7-6-9-15-13(12)20(17,18)16-11(5-2)10-19-3/h6-7,9,11,14,16H,4-5,8,10H2,1-3H3 |
| InChIKey | KFKPWFPTYKXJDA-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.48 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |