C10H17NO2Si — CID 10330796
2-trimethylsilyl-4,7,8,8a-tetrahydropyrrolo[2,1-b][1,3]oxazin-6-one (PubChem CID 10330796) has the molecular formula C10H17NO2Si and a molecular weight of 211.34 g/mol. Its IUPAC name is 2-trimethylsilyl-4,7,8,8a-tetrahydropyrrolo[2,1-b][1,3]oxazin-6-one.
| Compound Name | 2-trimethylsilyl-4,7,8,8a-tetrahydropyrrolo[2,1-b][1,3]oxazin-6-one |
|---|---|
| PubChem CID | 10330796 |
| Molecular Formula | C10H17NO2Si |
| Molecular Weight | 211.34 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 2-trimethylsilyl-4,7,8,8a-tetrahydropyrrolo[2,1-b][1,3]oxazin-6-one |
| SMILES | C[Si](C)(C)C1=CCN2C(=O)CCC2O1 |
| InChI | InChI=1S/C10H17NO2Si/c1-14(2,3)10-6-7-11-8(12)4-5-9(11)13-10/h6,9H,4-5,7H2,1-3H3 |
| InChIKey | JUUAMDHCEYQNSW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.34 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|