About 5-pyrazol-1-yl-1H-1,6-naphthyridin-2-one
5-pyrazol-1-yl-1H-1,6-naphthyridin-2-one (PubChem CID 10330804) has the molecular formula C11H8N4O
and a molecular weight of 212.21 g/mol. Its IUPAC name is 5-pyrazol-1-yl-1H-1,6-naphthyridin-2-one.
Molecular Properties
| Compound Name | 5-pyrazol-1-yl-1H-1,6-naphthyridin-2-one |
| PubChem CID | 10330804 |
| Molecular Formula | C11H8N4O |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 5-pyrazol-1-yl-1H-1,6-naphthyridin-2-one |
| SMILES | O=c1ccc2c(-n3cccn3)nccc2[nH]1 |
| InChI | InChI=1S/C11H8N4O/c16-10-3-2-8-9(14-10)4-6-12-11(8)15-7-1-5-13-15/h1-7H,(H,14,16) |
| InChIKey | BMXNJIMWIPKMMU-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-pyrazol-1-yl-1H-1,6-naphthyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-pyrazol-1-yl-1H-1,6-naphthyridin-2-one?
The IUPAC name of 5-pyrazol-1-yl-1H-1,6-naphthyridin-2-one (CID 10330804) is 5-pyrazol-1-yl-1H-1,6-naphthyridin-2-one.
What is the SMILES notation for 5-pyrazol-1-yl-1H-1,6-naphthyridin-2-one?
The canonical SMILES for 5-pyrazol-1-yl-1H-1,6-naphthyridin-2-one is O=c1ccc2c(-n3cccn3)nccc2[nH]1.
What is the InChIKey of 5-pyrazol-1-yl-1H-1,6-naphthyridin-2-one?
The InChIKey is BMXNJIMWIPKMMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N4O/c16-10-3-2-8-9(14-10)4-6-12-11(8)15-7-1-5-13-15/h1-7H,(H,14,16).
What are the key properties of 5-pyrazol-1-yl-1H-1,6-naphthyridin-2-one?
5-pyrazol-1-yl-1H-1,6-naphthyridin-2-one has a molecular weight of 212.21 g/mol, XLogP of 1.11, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-pyrazol-1-yl-1H-1,6-naphthyridin-2-one is sourced from PubChem (CID 10330804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).