C10H20N2O3S — CID 103308078
2-ethyl-N-propan-2-ylsulfonylpyrrolidine-2-carboxamide (PubChem CID 103308078) has the molecular formula C10H20N2O3S and a molecular weight of 248.35 g/mol. Its IUPAC name is 2-ethyl-N-propan-2-ylsulfonylpyrrolidine-2-carboxamide.
| Compound Name | 2-ethyl-N-propan-2-ylsulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 103308078 |
| Molecular Formula | C10H20N2O3S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 2-ethyl-N-propan-2-ylsulfonylpyrrolidine-2-carboxamide |
| SMILES | CCC1(C(=O)NS(=O)(=O)C(C)C)CCCN1 |
| InChI | InChI=1S/C10H20N2O3S/c1-4-10(6-5-7-11-10)9(13)12-16(14,15)8(2)3/h8,11H,4-7H2,1-3H3,(H,12,13) |
| InChIKey | SQZFUPZGGPJUAO-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |